C12H26O2Si — CID 151959610
2,2-diethoxyethyl(hex-5-enyl)silane (PubChem CID 151959610) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is 2,2-diethoxyethyl(hex-5-enyl)silane.
| Compound Name | 2,2-diethoxyethyl(hex-5-enyl)silane |
|---|---|
| PubChem CID | 151959610 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2,2-diethoxyethyl(hex-5-enyl)silane |
| SMILES | C=CCCCC[SiH2]CC(OCC)OCC |
| InChI | InChI=1S/C12H26O2Si/c1-4-7-8-9-10-15-11-12(13-5-2)14-6-3/h4,12H,1,5-11,15H2,2-3H3 |
| InChIKey | TYJCWIRKXCIQHD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|