C15H33NO2Si — CID 123811394
3-(2,2-diethoxyethylsilyl)-N-hexylpropan-1-imine (PubChem CID 123811394) has the molecular formula C15H33NO2Si and a molecular weight of 287.52 g/mol. Its IUPAC name is 3-(2,2-diethoxyethylsilyl)-N-hexylpropan-1-imine.
| Compound Name | 3-(2,2-diethoxyethylsilyl)-N-hexylpropan-1-imine |
|---|---|
| PubChem CID | 123811394 |
| Molecular Formula | C15H33NO2Si |
| Molecular Weight | 287.52 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | 3-(2,2-diethoxyethylsilyl)-N-hexylpropan-1-imine |
| SMILES | CCCCCC/N=C/CC[SiH2]CC(OCC)OCC |
| InChI | InChI=1S/C15H33NO2Si/c1-4-7-8-9-11-16-12-10-13-19-14-15(17-5-2)18-6-3/h12,15H,4-11,13-14,19H2,1-3H3/b16-12+ |
| InChIKey | JVTXPYZKNKSSCP-FOWTUZBSSA-N |
| XLogP | 3.43 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|