About 3-heptyliminopropyl propanoate
3-heptyliminopropyl propanoate (PubChem CID 175487113) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-heptyliminopropyl propanoate.
Molecular Properties
| Compound Name | 3-heptyliminopropyl propanoate |
| PubChem CID | 175487113 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 3-heptyliminopropyl propanoate |
| SMILES | CCCCCCC/N=C/CCOC(=O)CC |
| InChI | InChI=1S/C13H25NO2/c1-3-5-6-7-8-10-14-11-9-12-16-13(15)4-2/h11H,3-10,12H2,1-2H3/b14-11+ |
| InChIKey | IOIHKNAMBCGYOR-SDNWHVSQSA-N |
| XLogP | 3.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-heptyliminopropyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptyliminopropyl propanoate?
The IUPAC name of 3-heptyliminopropyl propanoate (CID 175487113) is 3-heptyliminopropyl propanoate.
What is the SMILES notation for 3-heptyliminopropyl propanoate?
The canonical SMILES for 3-heptyliminopropyl propanoate is CCCCCCC/N=C/CCOC(=O)CC.
What is the InChIKey of 3-heptyliminopropyl propanoate?
The InChIKey is IOIHKNAMBCGYOR-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H25NO2/c1-3-5-6-7-8-10-14-11-9-12-16-13(15)4-2/h11H,3-10,12H2,1-2H3/b14-11+.
What are the key properties of 3-heptyliminopropyl propanoate?
3-heptyliminopropyl propanoate has a molecular weight of 227.35 g/mol, XLogP of 3.37, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptyliminopropyl propanoate is sourced from PubChem (CID 175487113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).