C14H29NO3Si — CID 152696796
N-[4-(2,2-diethoxyethylsilyl)butyl]-2-methylprop-2-enamide (PubChem CID 152696796) has the molecular formula C14H29NO3Si and a molecular weight of 287.48 g/mol. Its IUPAC name is N-[4-(2,2-diethoxyethylsilyl)butyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-(2,2-diethoxyethylsilyl)butyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 152696796 |
| Molecular Formula | C14H29NO3Si |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[4-(2,2-diethoxyethylsilyl)butyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC[SiH2]CC(OCC)OCC |
| InChI | InChI=1S/C14H29NO3Si/c1-5-17-13(18-6-2)11-19-10-8-7-9-15-14(16)12(3)4/h13H,3,5-11,19H2,1-2,4H3,(H,15,16) |
| InChIKey | ZQSRFQLIAFHNSQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|