C16H33NO4Si — CID 58330356
2-methyl-N-(6-triethoxysilylhexyl)prop-2-enamide (PubChem CID 58330356) has the molecular formula C16H33NO4Si and a molecular weight of 331.53 g/mol. Its IUPAC name is 2-methyl-N-(6-triethoxysilylhexyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(6-triethoxysilylhexyl)prop-2-enamide |
|---|---|
| PubChem CID | 58330356 |
| Molecular Formula | C16H33NO4Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | 2-methyl-N-(6-triethoxysilylhexyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C16H33NO4Si/c1-6-19-22(20-7-2,21-8-3)14-12-10-9-11-13-17-16(18)15(4)5/h4,6-14H2,1-3,5H3,(H,17,18) |
| InChIKey | WOQYGSAEYQUMQO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|