C28H64N2O7Si6 — CID 87119608
2-methyl-N-[4-[[4-(2-methylprop-2-enoylamino)butyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]butyl]prop-2-enamide (PubChem CID 87119608) has the molecular formula C28H64N2O7Si6 and a molecular weight of 709.34 g/mol. Its IUPAC name is 2-methyl-N-[4-[[4-(2-methylprop-2-enoylamino)butyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]butyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[4-[[4-(2-methylprop-2-enoylamino)butyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 87119608 |
| Molecular Formula | C28H64N2O7Si6 |
| Molecular Weight | 709.34 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | 2-methyl-N-[4-[[4-(2-methylprop-2-enoylamino)butyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]butyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](CCCCNC(=O)C(=C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H64N2O7Si6/c1-25(2)27(31)29-21-17-19-23-42(33-38(5,6)7,34-39(8,9)10)37-43(35-40(11,12)13,36-41(14,15)16)24-20-18-22-30-28(32)26(3)4/h1,3,17-24H2,2,4-16H3,(H,29,31)(H,30,32) |
| InChIKey | XIKNMNBQYKMHAN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.34 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|