C19H45NO4Si4 — CID 54537406
2-methyl-N-[3-tris[[ethyl(dimethyl)silyl]oxy]silylpropyl]prop-2-enamide (PubChem CID 54537406) has the molecular formula C19H45NO4Si4 and a molecular weight of 463.92 g/mol. Its IUPAC name is 2-methyl-N-[3-tris[[ethyl(dimethyl)silyl]oxy]silylpropyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-tris[[ethyl(dimethyl)silyl]oxy]silylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 54537406 |
| Molecular Formula | C19H45NO4Si4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 2-methyl-N-[3-tris[[ethyl(dimethyl)silyl]oxy]silylpropyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC[Si](O[Si](C)(C)CC)(O[Si](C)(C)CC)O[Si](C)(C)CC |
| InChI | InChI=1S/C19H45NO4Si4/c1-12-25(6,7)22-28(23-26(8,9)13-2,24-27(10,11)14-3)17-15-16-20-19(21)18(4)5/h4,12-17H2,1-3,5-11H3,(H,20,21) |
| InChIKey | ZATIQKOBPCTUJN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|