C17H35NO3Si — CID 169083674
N-[8-[diethoxy(methyl)silyl]octyl]-2-methylprop-2-enamide (PubChem CID 169083674) has the molecular formula C17H35NO3Si and a molecular weight of 329.56 g/mol. Its IUPAC name is N-[8-[diethoxy(methyl)silyl]octyl]-2-methylprop-2-enamide.
| Compound Name | N-[8-[diethoxy(methyl)silyl]octyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 169083674 |
| Molecular Formula | C17H35NO3Si |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | N-[8-[diethoxy(methyl)silyl]octyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCCCC[Si](C)(OCC)OCC |
| InChI | InChI=1S/C17H35NO3Si/c1-6-20-22(5,21-7-2)15-13-11-9-8-10-12-14-18-17(19)16(3)4/h3,6-15H2,1-2,4-5H3,(H,18,19) |
| InChIKey | ZYJYATCAFCHYDK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|