C18H43NO4Si4 — CID 54350346
N-[3-[[dimethyl(propyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl]-2-methylprop-2-enamide (PubChem CID 54350346) has the molecular formula C18H43NO4Si4 and a molecular weight of 449.89 g/mol. Its IUPAC name is N-[3-[[dimethyl(propyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-[[dimethyl(propyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 54350346 |
| Molecular Formula | C18H43NO4Si4 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[3-[[dimethyl(propyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)CCC |
| InChI | InChI=1S/C18H43NO4Si4/c1-12-15-26(10,11)23-27(21-24(4,5)6,22-25(7,8)9)16-13-14-19-18(20)17(2)3/h2,12-16H2,1,3-11H3,(H,19,20) |
| InChIKey | UFGZDMJAQJPXSZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|