C24H58BrN2O3Si4+ — CID 157309870
4-[[2-[dimethyl(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]butyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;hydrobromide (PubChem CID 157309870) has the molecular formula C24H58BrN2O3Si4+ and a molecular weight of 614.99 g/mol. Its IUPAC name is 4-[[2-[dimethyl(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]butyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;hydrobromide.
| Compound Name | 4-[[2-[dimethyl(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]butyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;hydrobromide |
|---|---|
| PubChem CID | 157309870 |
| Molecular Formula | C24H58BrN2O3Si4+ |
| Molecular Weight | 614.99 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 4-[[2-[dimethyl(trimethylsilyloxy)silyl]ethyl-dimethylsilyl]oxy-dimethylsilyl]butyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;hydrobromide |
| SMILES | Br.C=C(C)C(=O)NCCC[N+](C)(C)CCCC[Si](C)(C)O[Si](C)(C)CC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H56N2O3Si4.BrH/c1-23(2)24(27)25-17-16-19-26(3,4)18-14-15-20-31(8,9)29-33(12,13)22-21-32(10,11)28-30(5,6)7;/h1,14-22H2,2-13H3;1H/p+1 |
| InChIKey | LSEKUBHFTQLOGW-UHFFFAOYSA-O |
| XLogP | 6.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.99 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|