C17H34N2O4S — CID 122622583
8-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]octane-1-sulfonate (PubChem CID 122622583) has the molecular formula C17H34N2O4S and a molecular weight of 362.54 g/mol. Its IUPAC name is 8-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]octane-1-sulfonate.
| Compound Name | 8-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]octane-1-sulfonate |
|---|---|
| PubChem CID | 122622583 |
| Molecular Formula | C17H34N2O4S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 8-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]octane-1-sulfonate |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CCCCCCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H34N2O4S/c1-16(2)17(20)18-12-11-14-19(3,4)13-9-7-5-6-8-10-15-24(21,22)23/h1,5-15H2,2-4H3,(H-,18,20,21,22,23) |
| InChIKey | VYYAWMKMUSZAIL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|