C14H33NO3Si3 — CID 173466192
2-methyl-N-[4-silyl-4,4-bis(trimethylsilyloxy)butyl]prop-2-enamide (PubChem CID 173466192) has the molecular formula C14H33NO3Si3 and a molecular weight of 347.68 g/mol. Its IUPAC name is 2-methyl-N-[4-silyl-4,4-bis(trimethylsilyloxy)butyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[4-silyl-4,4-bis(trimethylsilyloxy)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 173466192 |
| Molecular Formula | C14H33NO3Si3 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-methyl-N-[4-silyl-4,4-bis(trimethylsilyloxy)butyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC([SiH3])(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H33NO3Si3/c1-12(2)13(16)15-11-9-10-14(19,17-20(3,4)5)18-21(6,7)8/h1,9-11H2,2-8,19H3,(H,15,16) |
| InChIKey | RZPDSQXMPQSIKG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|