C14H35NO3Si4 — CID 123712703
N-[3-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylpropyl]-2-methylprop-2-enamide (PubChem CID 123712703) has the molecular formula C14H35NO3Si4 and a molecular weight of 377.78 g/mol. Its IUPAC name is N-[3-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylpropyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylpropyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 123712703 |
| Molecular Formula | C14H35NO3Si4 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[3-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylpropyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC[SiH2]O[Si](C)(C)CC[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C14H35NO3Si4/c1-13(2)14(16)15-9-8-10-19-18-22(6,7)12-11-20-17-21(3,4)5/h1,8-12,19-20H2,2-7H3,(H,15,16) |
| InChIKey | GCHHNJPXXZWVOD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|