C11H29NO2Si2 — CID 158714381
methane;N-(3-trimethylsilyloxysilylpropyl)prop-2-enamide (PubChem CID 158714381) has the molecular formula C11H29NO2Si2 and a molecular weight of 263.53 g/mol. Its IUPAC name is methane;N-(3-trimethylsilyloxysilylpropyl)prop-2-enamide.
| Compound Name | methane;N-(3-trimethylsilyloxysilylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 158714381 |
| Molecular Formula | C11H29NO2Si2 |
| Molecular Weight | 263.53 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | methane;N-(3-trimethylsilyloxysilylpropyl)prop-2-enamide |
| SMILES | C.C.C=CC(=O)NCCC[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C9H21NO2Si2.2CH4/c1-5-9(11)10-7-6-8-13-12-14(2,3)4;;/h5H,1,6-8,13H2,2-4H3,(H,10,11);2*1H4 |
| InChIKey | IJCYGQQPGFXLMU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|