C17H38O6Si4 — CID 123386475
2-[1,7-bis(trimethylsilyloxysilyl)heptan-4-ylidene]butanedioic acid (PubChem CID 123386475) has the molecular formula C17H38O6Si4 and a molecular weight of 450.83 g/mol. Its IUPAC name is 2-[1,7-bis(trimethylsilyloxysilyl)heptan-4-ylidene]butanedioic acid.
| Compound Name | 2-[1,7-bis(trimethylsilyloxysilyl)heptan-4-ylidene]butanedioic acid |
|---|---|
| PubChem CID | 123386475 |
| Molecular Formula | C17H38O6Si4 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[1,7-bis(trimethylsilyloxysilyl)heptan-4-ylidene]butanedioic acid |
| SMILES | C[Si](C)(C)O[SiH2]CCCC(CCC[SiH2]O[Si](C)(C)C)=C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H38O6Si4/c1-26(2,3)22-24-11-7-9-14(15(17(20)21)13-16(18)19)10-8-12-25-23-27(4,5)6/h7-13,24-25H2,1-6H3,(H,18,19)(H,20,21) |
| InChIKey | RFVHJTAKLRFJDJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|