C11H28O4Si4 — CID 158813384
[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylmethyl prop-2-enoate (PubChem CID 158813384) has the molecular formula C11H28O4Si4 and a molecular weight of 336.69 g/mol. Its IUPAC name is [dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylmethyl prop-2-enoate.
| Compound Name | [dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 158813384 |
| Molecular Formula | C11H28O4Si4 |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OC[SiH2]O[Si](C)(C)CC[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C11H28O4Si4/c1-7-11(12)13-10-17-15-19(5,6)9-8-16-14-18(2,3)4/h7H,1,8-10,16-17H2,2-6H3 |
| InChIKey | JMRYACFZBWALND-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|