C16H46O6Si8 — CID 123807488
[[[dimethyl(trimethylsilyloxysilylmethyl)silyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl prop-2-enoate (PubChem CID 123807488) has the molecular formula C16H46O6Si8 and a molecular weight of 559.23 g/mol. Its IUPAC name is [[[dimethyl(trimethylsilyloxysilylmethyl)silyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl prop-2-enoate.
| Compound Name | [[[dimethyl(trimethylsilyloxysilylmethyl)silyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 123807488 |
| Molecular Formula | C16H46O6Si8 |
| Molecular Weight | 559.23 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | [[[dimethyl(trimethylsilyloxysilylmethyl)silyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl-dimethylsilyl]oxysilylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OC[SiH2]O[Si](C)(C)C[SiH2]O[Si](C)(C)C[SiH2]O[Si](C)(C)C[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C16H46O6Si8/c1-11-16(17)18-12-23-20-28(5,6)14-25-22-30(9,10)15-26-21-29(7,8)13-24-19-27(2,3)4/h11H,1,12-15,23-26H2,2-10H3 |
| InChIKey | IYEBAZVYVPOGSH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|