About 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate
3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate (PubChem CID 123433875) has the molecular formula C12H28O3Si2
and a molecular weight of 276.52 g/mol. Its IUPAC name is 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate |
| PubChem CID | 123433875 |
| Molecular Formula | C12H28O3Si2 |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCC[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C12H28O3Si2/c1-7-12(2,3)11(13)14-9-8-10-16-15-17(4,5)6/h7-10,16H2,1-6H3 |
| InChIKey | GVGCZWHKADNDDU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate?
The IUPAC name of 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate (CID 123433875) is 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate.
What is the SMILES notation for 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate?
The canonical SMILES for 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCCC[SiH2]O[Si](C)(C)C.
What is the InChIKey of 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate?
The InChIKey is GVGCZWHKADNDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O3Si2/c1-7-12(2,3)11(13)14-9-8-10-16-15-17(4,5)6/h7-10,16H2,1-6H3.
What are the key properties of 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate?
3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate has a molecular weight of 276.52 g/mol, XLogP of 2.71, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilyloxysilylpropyl 2,2-dimethylbutanoate is sourced from PubChem (CID 123433875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).