C17H42O2Si4 — CID 58927101
2-tris(trimethylsilyl)silylethyl 2,2-dimethylbutanoate (PubChem CID 58927101) has the molecular formula C17H42O2Si4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-tris(trimethylsilyl)silylethyl 2,2-dimethylbutanoate.
| Compound Name | 2-tris(trimethylsilyl)silylethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58927101 |
| Molecular Formula | C17H42O2Si4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-tris(trimethylsilyl)silylethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H42O2Si4/c1-13-17(2,3)16(18)19-14-15-23(20(4,5)6,21(7,8)9)22(10,11)12/h13-15H2,1-12H3 |
| InChIKey | COSLMMMZYMMGSU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|