C13H28O2Si — CID 59893089
(2-methyl-2-trimethylsilylpropyl) 2,2-dimethylbutanoate (PubChem CID 59893089) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (2-methyl-2-trimethylsilylpropyl) 2,2-dimethylbutanoate.
| Compound Name | (2-methyl-2-trimethylsilylpropyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59893089 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2-methyl-2-trimethylsilylpropyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-9-12(2,3)11(14)15-10-13(4,5)16(6,7)8/h9-10H2,1-8H3 |
| InChIKey | KRVFQQNBTWIMBB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|