C16H40O5Si4 — CID 20708550
tris(trimethylsilyloxy)silylmethyl 2,2-dimethylbutanoate (PubChem CID 20708550) has the molecular formula C16H40O5Si4 and a molecular weight of 424.84 g/mol. Its IUPAC name is tris(trimethylsilyloxy)silylmethyl 2,2-dimethylbutanoate.
| Compound Name | tris(trimethylsilyloxy)silylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20708550 |
| Molecular Formula | C16H40O5Si4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tris(trimethylsilyloxy)silylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H40O5Si4/c1-13-16(2,3)15(17)18-14-25(19-22(4,5)6,20-23(7,8)9)21-24(10,11)12/h13-14H2,1-12H3 |
| InChIKey | HHTCMHFNYFRYFX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|