C15H32O2Si — CID 22889670
(4-methyl-4-trimethylsilylpentyl) 2,2-dimethylbutanoate (PubChem CID 22889670) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is (4-methyl-4-trimethylsilylpentyl) 2,2-dimethylbutanoate.
| Compound Name | (4-methyl-4-trimethylsilylpentyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 22889670 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (4-methyl-4-trimethylsilylpentyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCC(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-9-14(2,3)13(16)17-12-10-11-15(4,5)18(6,7)8/h9-12H2,1-8H3 |
| InChIKey | OUALNRGPXVJYPU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|