About 4-oxopentyl 2,2-dimethylbutanoate
4-oxopentyl 2,2-dimethylbutanoate (PubChem CID 167427927) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-oxopentyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | 4-oxopentyl 2,2-dimethylbutanoate |
| PubChem CID | 167427927 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 4-oxopentyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCC(C)=O |
| InChI | InChI=1S/C11H20O3/c1-5-11(3,4)10(13)14-8-6-7-9(2)12/h5-8H2,1-4H3 |
| InChIKey | AIKFZJJNTGWKBV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentyl 2,2-dimethylbutanoate?
The IUPAC name of 4-oxopentyl 2,2-dimethylbutanoate (CID 167427927) is 4-oxopentyl 2,2-dimethylbutanoate.
What is the SMILES notation for 4-oxopentyl 2,2-dimethylbutanoate?
The canonical SMILES for 4-oxopentyl 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCCCC(C)=O.
What is the InChIKey of 4-oxopentyl 2,2-dimethylbutanoate?
The InChIKey is AIKFZJJNTGWKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-5-11(3,4)10(13)14-8-6-7-9(2)12/h5-8H2,1-4H3.
What are the key properties of 4-oxopentyl 2,2-dimethylbutanoate?
4-oxopentyl 2,2-dimethylbutanoate has a molecular weight of 200.28 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentyl 2,2-dimethylbutanoate is sourced from PubChem (CID 167427927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).