C17H32O4 — CID 59819219
[4-oxo-4-(2,3,3-trimethylbutan-2-yloxy)butyl] 2,2-dimethylbutanoate (PubChem CID 59819219) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is [4-oxo-4-(2,3,3-trimethylbutan-2-yloxy)butyl] 2,2-dimethylbutanoate.
| Compound Name | [4-oxo-4-(2,3,3-trimethylbutan-2-yloxy)butyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59819219 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [4-oxo-4-(2,3,3-trimethylbutan-2-yloxy)butyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCC(=O)OC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4/c1-9-16(5,6)14(19)20-12-10-11-13(18)21-17(7,8)15(2,3)4/h9-12H2,1-8H3 |
| InChIKey | WLXDBYHAXNGPBI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|