C9H20O5Si — CID 140697808
3-tritritiooxysilylpropyl 2,2-dimethylbutanoate (PubChem CID 140697808) has the molecular formula C9H20O5Si and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-tritritiooxysilylpropyl 2,2-dimethylbutanoate.
| Compound Name | 3-tritritiooxysilylpropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 140697808 |
| Molecular Formula | C9H20O5Si |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-tritritiooxysilylpropyl 2,2-dimethylbutanoate |
| SMILES | [3H]O[Si](CCCOC(=O)C(C)(C)CC)(O[3H])O[3H] |
| InChI | InChI=1S/C9H20O5Si/c1-4-9(2,3)8(10)14-6-5-7-15(11,12)13/h11-13H,4-7H2,1-3H3/i11T,12T,13T |
| InChIKey | XBEWCSBPPNQVKR-ASYIRLSGSA-N |
| XLogP | 0.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|