C17H28F6O4 — CID 123435278
2,2,2-trifluoroethyl 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate (PubChem CID 123435278) has the molecular formula C17H28F6O4 and a molecular weight of 410.40 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate.
| Compound Name | 2,2,2-trifluoroethyl 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123435278 |
| Molecular Formula | C17H28F6O4 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2,2,2-trifluoroethyl 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)C(F)(F)F.CCC(C)(C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H15F3O2.C8H13F3O2/c1-5-8(3,4)7(13)14-6(2)9(10,11)12;1-4-7(2,3)6(12)13-5-8(9,10)11/h6H,5H2,1-4H3;4-5H2,1-3H3 |
| InChIKey | HJDUTWQBNZYZLE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |