C20H26F14O4 — CID 90775897
1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;2,2,3,3,4,4,5,5-octafluoropentyl 2,2-dimethylbutanoate (PubChem CID 90775897) has the molecular formula C20H26F14O4 and a molecular weight of 596.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;2,2,3,3,4,4,5,5-octafluoropentyl 2,2-dimethylbutanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;2,2,3,3,4,4,5,5-octafluoropentyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90775897 |
| Molecular Formula | C20H26F14O4 |
| Molecular Weight | 596.40 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;2,2,3,3,4,4,5,5-octafluoropentyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C(F)(F)F)C(F)(F)F.CCC(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H14F8O2.C9H12F6O2/c1-4-8(2,3)7(20)21-5-9(14,15)11(18,19)10(16,17)6(12)13;1-4-7(2,3)6(16)17-5(8(10,11)12)9(13,14)15/h6H,4-5H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | SSESZKAFNGJMRA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.40 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|