C12H13F11O2 — CID 59940556
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-dimethylbutanoate (PubChem CID 59940556) has the molecular formula C12H13F11O2 and a molecular weight of 398.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-dimethylbutanoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59940556 |
| Molecular Formula | C12H13F11O2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F11O2/c1-4-7(2,3)6(24)25-5-8(13,14)9(15,16)10(17,18)11(19,20)12(21,22)23/h4-5H2,1-3H3 |
| InChIKey | NZMUWCQYPNGRAB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|