C14H12F16O2 — CID 58881419
2,2,3,3,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-fluoro-2-methylbutanoate (PubChem CID 58881419) has the molecular formula C14H12F16O2 and a molecular weight of 516.22 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-fluoro-2-methylbutanoate.
| Compound Name | 2,2,3,3,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 58881419 |
| Molecular Formula | C14H12F16O2 |
| Molecular Weight | 516.22 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 2,2,3,3,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OCC(F)(F)C(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F16O2/c1-3-7(2,15)6(31)32-5-10(20,21)8(16,17)4-9(18,19)11(22,23)12(24,25)13(26,27)14(28,29)30/h3-5H2,1-2H3 |
| InChIKey | YRLODHJTUCUAPL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.22 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|