C10H4F16O3 — CID 99769571
2,2,3,3,3-pentafluoropropyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate (PubChem CID 99769571) has the molecular formula C10H4F16O3 and a molecular weight of 476.11 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate |
|---|---|
| PubChem CID | 99769571 |
| Molecular Formula | C10H4F16O3 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl carbonate |
| SMILES | O=C(OCC(F)(F)C(F)(F)F)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4F16O3/c11-4(12,1-28-3(27)29-2-5(13,14)9(21,22)23)6(15,16)7(17,18)8(19,20)10(24,25)26/h1-2H2 |
| InChIKey | INVAGXFLVBYMGG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|