C12H10F14O2 — CID 58937695
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 2-fluoro-2-methylbutanoate (PubChem CID 58937695) has the molecular formula C12H10F14O2 and a molecular weight of 452.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 2-fluoro-2-methylbutanoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 58937695 |
| Molecular Formula | C12H10F14O2 |
| Molecular Weight | 452.18 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F14O2/c1-3-6(2,13)5(27)28-4-7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)26/h3-4H2,1-2H3 |
| InChIKey | AIFAUWHVJJJOGN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.18 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|