C10H10F9IO2 — CID 153324107
ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-iodo-2-methylheptanoate (PubChem CID 153324107) has the molecular formula C10H10F9IO2 and a molecular weight of 460.07 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-iodo-2-methylheptanoate.
| Compound Name | ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-iodo-2-methylheptanoate |
|---|---|
| PubChem CID | 153324107 |
| Molecular Formula | C10H10F9IO2 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-iodo-2-methylheptanoate |
| SMILES | CCOC(=O)C(C)(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F9IO2/c1-3-22-5(21)6(2,20)4-7(11,12)8(13,14)9(15,16)10(17,18)19/h3-4H2,1-2H3 |
| InChIKey | XHPCTYYBGLATBE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|