C14H10F18O2 — CID 139719370
ethyl 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-octadecafluoro-3-methylundecanoate (PubChem CID 139719370) has the molecular formula C14H10F18O2 and a molecular weight of 552.20 g/mol. Its IUPAC name is ethyl 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-octadecafluoro-3-methylundecanoate.
| Compound Name | ethyl 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-octadecafluoro-3-methylundecanoate |
|---|---|
| PubChem CID | 139719370 |
| Molecular Formula | C14H10F18O2 |
| Molecular Weight | 552.20 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | ethyl 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-octadecafluoro-3-methylundecanoate |
| SMILES | CCOC(=O)CC(C)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F18O2/c1-3-34-5(33)4-6(2,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)32/h3-4H2,1-2H3 |
| InChIKey | BROWFJKMMIADSN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.20 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|