C13H18F6O6 — CID 154286431
ethyl 2-[5-(2-ethoxy-2-oxoethoxy)-2,2,3,3,4,4-hexafluoropentoxy]acetate (PubChem CID 154286431) has the molecular formula C13H18F6O6 and a molecular weight of 384.27 g/mol. Its IUPAC name is ethyl 2-[5-(2-ethoxy-2-oxoethoxy)-2,2,3,3,4,4-hexafluoropentoxy]acetate.
| Compound Name | ethyl 2-[5-(2-ethoxy-2-oxoethoxy)-2,2,3,3,4,4-hexafluoropentoxy]acetate |
|---|---|
| PubChem CID | 154286431 |
| Molecular Formula | C13H18F6O6 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | ethyl 2-[5-(2-ethoxy-2-oxoethoxy)-2,2,3,3,4,4-hexafluoropentoxy]acetate |
| SMILES | CCOC(=O)COCC(F)(F)C(F)(F)C(F)(F)COCC(=O)OCC |
| InChI | InChI=1S/C13H18F6O6/c1-3-24-9(20)5-22-7-11(14,15)13(18,19)12(16,17)8-23-6-10(21)25-4-2/h3-8H2,1-2H3 |
| InChIKey | FCDIDHBNRZIEPF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|