C11H9ClF12O2 — CID 14984513
ethyl 9-chloro-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanoate (PubChem CID 14984513) has the molecular formula C11H9ClF12O2 and a molecular weight of 436.62 g/mol. Its IUPAC name is ethyl 9-chloro-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanoate.
| Compound Name | ethyl 9-chloro-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanoate |
|---|---|
| PubChem CID | 14984513 |
| Molecular Formula | C11H9ClF12O2 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | ethyl 9-chloro-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanoate |
| SMILES | CCOC(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C11H9ClF12O2/c1-2-26-5(25)3-4-6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(12,23)24/h2-4H2,1H3 |
| InChIKey | DITYSEAYTVFEAY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|