C10H11ClF8O2 — CID 15751750
ethyl 7-chloro-4,4,5,5,6,6,7,7-octafluoro-3-methylheptanoate (PubChem CID 15751750) has the molecular formula C10H11ClF8O2 and a molecular weight of 350.63 g/mol. Its IUPAC name is ethyl 7-chloro-4,4,5,5,6,6,7,7-octafluoro-3-methylheptanoate.
| Compound Name | ethyl 7-chloro-4,4,5,5,6,6,7,7-octafluoro-3-methylheptanoate |
|---|---|
| PubChem CID | 15751750 |
| Molecular Formula | C10H11ClF8O2 |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | ethyl 7-chloro-4,4,5,5,6,6,7,7-octafluoro-3-methylheptanoate |
| SMILES | CCOC(=O)CC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C10H11ClF8O2/c1-3-21-6(20)4-5(2)7(12,13)8(14,15)9(16,17)10(11,18)19/h5H,3-4H2,1-2H3 |
| InChIKey | YAWCKEQQLQVWNI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|