C6H8ClF3O4S — CID 124710098
ethyl (3S)-3-chlorosulfonyl-4,4,4-trifluorobutanoate (PubChem CID 124710098) has the molecular formula C6H8ClF3O4S and a molecular weight of 268.64 g/mol. Its IUPAC name is ethyl (3S)-3-chlorosulfonyl-4,4,4-trifluorobutanoate.
| Compound Name | ethyl (3S)-3-chlorosulfonyl-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 124710098 |
| Molecular Formula | C6H8ClF3O4S |
| Molecular Weight | 268.64 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | ethyl (3S)-3-chlorosulfonyl-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C[C@@H](C(F)(F)F)S(=O)(=O)Cl |
| InChI | InChI=1S/C6H8ClF3O4S/c1-2-14-5(11)3-4(6(8,9)10)15(7,12)13/h4H,2-3H2,1H3/t4-/m0/s1 |
| InChIKey | SBPCUYHLMPLYAI-BYPYZUCNSA-N |
| XLogP | 1.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.64 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |