C8H10F7NO2 — CID 171210387
ethyl (3R)-3-amino-4,4,5,5,6,6,6-heptafluorohexanoate (PubChem CID 171210387) has the molecular formula C8H10F7NO2 and a molecular weight of 285.16 g/mol. Its IUPAC name is ethyl (3R)-3-amino-4,4,5,5,6,6,6-heptafluorohexanoate.
| Compound Name | ethyl (3R)-3-amino-4,4,5,5,6,6,6-heptafluorohexanoate |
|---|---|
| PubChem CID | 171210387 |
| Molecular Formula | C8H10F7NO2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | ethyl (3R)-3-amino-4,4,5,5,6,6,6-heptafluorohexanoate |
| SMILES | CCOC(=O)C[C@@H](N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7NO2/c1-2-18-5(17)3-4(16)6(9,10)7(11,12)8(13,14)15/h4H,2-3,16H2,1H3/t4-/m1/s1 |
| InChIKey | JPTVJUJBLGMRMA-SCSAIBSYSA-N |
| XLogP | 2.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|