C8H7F9O2 — CID 170871929
ethyl 3,4,4,5,5,5-hexafluoro-3-(trifluoromethyl)pentanoate (PubChem CID 170871929) has the molecular formula C8H7F9O2 and a molecular weight of 306.12 g/mol. Its IUPAC name is ethyl 3,4,4,5,5,5-hexafluoro-3-(trifluoromethyl)pentanoate.
| Compound Name | ethyl 3,4,4,5,5,5-hexafluoro-3-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 170871929 |
| Molecular Formula | C8H7F9O2 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | ethyl 3,4,4,5,5,5-hexafluoro-3-(trifluoromethyl)pentanoate |
| SMILES | CCOC(=O)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F9O2/c1-2-19-4(18)3-5(9,7(12,13)14)6(10,11)8(15,16)17/h2-3H2,1H3 |
| InChIKey | RQIJTPSBJNFAAQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|