C10H9F11O3 — CID 155658146
ethyl 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-4-(trifluoromethyl)heptanoate (PubChem CID 155658146) has the molecular formula C10H9F11O3 and a molecular weight of 386.16 g/mol. Its IUPAC name is ethyl 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-4-(trifluoromethyl)heptanoate.
| Compound Name | ethyl 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-4-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 155658146 |
| Molecular Formula | C10H9F11O3 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | ethyl 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-4-(trifluoromethyl)heptanoate |
| SMILES | CCOC(=O)C(O)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F11O3/c1-2-24-5(23)4(22)3-6(11,9(16,17)18)7(12,13)8(14,15)10(19,20)21/h4,22H,2-3H2,1H3 |
| InChIKey | TWEPFUHYDJEABB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|