C8H6F9IO2 — CID 153324206
methyl 4,5,5,6,6,6-hexafluoro-2-iodo-4-(trifluoromethyl)hexanoate (PubChem CID 153324206) has the molecular formula C8H6F9IO2 and a molecular weight of 432.02 g/mol. Its IUPAC name is methyl 4,5,5,6,6,6-hexafluoro-2-iodo-4-(trifluoromethyl)hexanoate.
| Compound Name | methyl 4,5,5,6,6,6-hexafluoro-2-iodo-4-(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 153324206 |
| Molecular Formula | C8H6F9IO2 |
| Molecular Weight | 432.02 g/mol |
| Exact Mass | 431.93 |
| IUPAC Name | methyl 4,5,5,6,6,6-hexafluoro-2-iodo-4-(trifluoromethyl)hexanoate |
| SMILES | COC(=O)C(I)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F9IO2/c1-20-4(19)3(18)2-5(9,7(12,13)14)6(10,11)8(15,16)17/h3H,2H2,1H3 |
| InChIKey | CLJOQURTEVMBFJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.02 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|