C9H9F9O2 — CID 155658022
methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptanoate (PubChem CID 155658022) has the molecular formula C9H9F9O2 and a molecular weight of 320.15 g/mol. Its IUPAC name is methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptanoate.
| Compound Name | methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptanoate |
|---|---|
| PubChem CID | 155658022 |
| Molecular Formula | C9H9F9O2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptanoate |
| SMILES | COC(=O)C(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9O2/c1-4(5(19)20-2)3-6(10,11)7(12,13)8(14,15)9(16,17)18/h4H,3H2,1-2H3 |
| InChIKey | ZHWNODWUPXVGQZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|