C9H8BrF9O2 — CID 155658105
ethyl 2-bromo-4,4,5,5,6,6,7,7,7-nonafluoroheptanoate (PubChem CID 155658105) has the molecular formula C9H8BrF9O2 and a molecular weight of 399.05 g/mol. Its IUPAC name is ethyl 2-bromo-4,4,5,5,6,6,7,7,7-nonafluoroheptanoate.
| Compound Name | ethyl 2-bromo-4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
|---|---|
| PubChem CID | 155658105 |
| Molecular Formula | C9H8BrF9O2 |
| Molecular Weight | 399.05 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | ethyl 2-bromo-4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
| SMILES | CCOC(=O)C(Br)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF9O2/c1-2-21-5(20)4(10)3-6(11,12)7(13,14)8(15,16)9(17,18)19/h4H,2-3H2,1H3 |
| InChIKey | NGFNXQBQQQCASI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.05 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|