About diethyl (2S)-2-bromobutanedioate
diethyl (2S)-2-bromobutanedioate (PubChem CID 10422366) has the molecular formula C8H13BrO4
and a molecular weight of 253.09 g/mol. Its IUPAC name is diethyl (2S)-2-bromobutanedioate.
Molecular Properties
| Compound Name | diethyl (2S)-2-bromobutanedioate |
| PubChem CID | 10422366 |
| Molecular Formula | C8H13BrO4 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | diethyl (2S)-2-bromobutanedioate |
| SMILES | CCOC(=O)C[C@H](Br)C(=O)OCC |
| InChI | InChI=1S/C8H13BrO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | RUIJMAUNJVDAEE-LURJTMIESA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2S)-2-bromobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2S)-2-bromobutanedioate?
The IUPAC name of diethyl (2S)-2-bromobutanedioate (CID 10422366) is diethyl (2S)-2-bromobutanedioate.
What is the SMILES notation for diethyl (2S)-2-bromobutanedioate?
The canonical SMILES for diethyl (2S)-2-bromobutanedioate is CCOC(=O)C[C@H](Br)C(=O)OCC.
What is the InChIKey of diethyl (2S)-2-bromobutanedioate?
The InChIKey is RUIJMAUNJVDAEE-LURJTMIESA-N. The full InChI is InChI=1S/C8H13BrO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h6H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of diethyl (2S)-2-bromobutanedioate?
diethyl (2S)-2-bromobutanedioate has a molecular weight of 253.09 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2S)-2-bromobutanedioate is sourced from PubChem (CID 10422366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).