About ethyl (2R)-2-bromopropanoate
ethyl (2R)-2-bromopropanoate (PubChem CID 7003709) has the molecular formula C5H9BrO2
and a molecular weight of 181.03 g/mol. Its IUPAC name is ethyl (2R)-2-bromopropanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-bromopropanoate |
| PubChem CID | 7003709 |
| Molecular Formula | C5H9BrO2 |
| Molecular Weight | 181.03 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | ethyl (2R)-2-bromopropanoate |
| SMILES | CCOC(=O)[C@@H](C)Br |
| InChI | InChI=1S/C5H9BrO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | ARFLASKVLJTEJD-SCSAIBSYSA-N |
| XLogP | 1.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.03 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2R)-2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-bromopropanoate?
The IUPAC name of ethyl (2R)-2-bromopropanoate (CID 7003709) is ethyl (2R)-2-bromopropanoate.
What is the SMILES notation for ethyl (2R)-2-bromopropanoate?
The canonical SMILES for ethyl (2R)-2-bromopropanoate is CCOC(=O)[C@@H](C)Br.
What is the InChIKey of ethyl (2R)-2-bromopropanoate?
The InChIKey is ARFLASKVLJTEJD-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H9BrO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of ethyl (2R)-2-bromopropanoate?
ethyl (2R)-2-bromopropanoate has a molecular weight of 181.03 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-bromopropanoate is sourced from PubChem (CID 7003709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).