About propanoyl 2-bromopropanoate
propanoyl 2-bromopropanoate (PubChem CID 87180539) has the molecular formula C6H9BrO3
and a molecular weight of 209.04 g/mol. Its IUPAC name is propanoyl 2-bromopropanoate.
Molecular Properties
| Compound Name | propanoyl 2-bromopropanoate |
| PubChem CID | 87180539 |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | propanoyl 2-bromopropanoate |
| SMILES | CCC(=O)OC(=O)C(C)Br |
| InChI | InChI=1S/C6H9BrO3/c1-3-5(8)10-6(9)4(2)7/h4H,3H2,1-2H3 |
| InChIKey | VJBRXBOPYGHPFQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyl 2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl 2-bromopropanoate?
The IUPAC name of propanoyl 2-bromopropanoate (CID 87180539) is propanoyl 2-bromopropanoate.
What is the SMILES notation for propanoyl 2-bromopropanoate?
The canonical SMILES for propanoyl 2-bromopropanoate is CCC(=O)OC(=O)C(C)Br.
What is the InChIKey of propanoyl 2-bromopropanoate?
The InChIKey is VJBRXBOPYGHPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO3/c1-3-5(8)10-6(9)4(2)7/h4H,3H2,1-2H3.
What are the key properties of propanoyl 2-bromopropanoate?
propanoyl 2-bromopropanoate has a molecular weight of 209.04 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl 2-bromopropanoate is sourced from PubChem (CID 87180539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).