About 2-bromopropanoyl (2S)-2-aminopropanoate
2-bromopropanoyl (2S)-2-aminopropanoate (PubChem CID 87794605) has the molecular formula C6H10BrNO3
and a molecular weight of 224.05 g/mol. Its IUPAC name is 2-bromopropanoyl (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | 2-bromopropanoyl (2S)-2-aminopropanoate |
| PubChem CID | 87794605 |
| Molecular Formula | C6H10BrNO3 |
| Molecular Weight | 224.05 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | 2-bromopropanoyl (2S)-2-aminopropanoate |
| SMILES | CC(Br)C(=O)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C6H10BrNO3/c1-3(7)5(9)11-6(10)4(2)8/h3-4H,8H2,1-2H3/t3?,4-/m0/s1 |
| InChIKey | CITIBUFNBUTKAW-BKLSDQPFSA-N |
| XLogP | 0.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.05 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropanoyl (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropanoyl (2S)-2-aminopropanoate?
The IUPAC name of 2-bromopropanoyl (2S)-2-aminopropanoate (CID 87794605) is 2-bromopropanoyl (2S)-2-aminopropanoate.
What is the SMILES notation for 2-bromopropanoyl (2S)-2-aminopropanoate?
The canonical SMILES for 2-bromopropanoyl (2S)-2-aminopropanoate is CC(Br)C(=O)OC(=O)[C@H](C)N.
What is the InChIKey of 2-bromopropanoyl (2S)-2-aminopropanoate?
The InChIKey is CITIBUFNBUTKAW-BKLSDQPFSA-N. The full InChI is InChI=1S/C6H10BrNO3/c1-3(7)5(9)11-6(10)4(2)8/h3-4H,8H2,1-2H3/t3?,4-/m0/s1.
What are the key properties of 2-bromopropanoyl (2S)-2-aminopropanoate?
2-bromopropanoyl (2S)-2-aminopropanoate has a molecular weight of 224.05 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropanoyl (2S)-2-aminopropanoate is sourced from PubChem (CID 87794605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).