C9H18N2O3 — CID 57005040
[(2S)-2-aminopropanoyl] (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 57005040) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is [(2S)-2-aminopropanoyl] (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [(2S)-2-aminopropanoyl] (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 57005040 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | [(2S)-2-aminopropanoyl] (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C9H18N2O3/c1-4-5(2)7(11)9(13)14-8(12)6(3)10/h5-7H,4,10-11H2,1-3H3/t5-,6-,7-/m0/s1 |
| InChIKey | KYTMLCOAJHNYJF-ACZMJKKPSA-N |
| XLogP | -0.22 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|