C12H21NO4 — CID 57061538
(3-methyl-2-oxopentanoyl) (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 57061538) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is (3-methyl-2-oxopentanoyl) (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | (3-methyl-2-oxopentanoyl) (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 57061538 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (3-methyl-2-oxopentanoyl) (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CCC(C)C(=O)C(=O)OC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C12H21NO4/c1-5-7(3)9(13)11(15)17-12(16)10(14)8(4)6-2/h7-9H,5-6,13H2,1-4H3/t7-,8?,9-/m0/s1 |
| InChIKey | PBCIQBCNHKGJPE-SMOXQLQSSA-N |
| XLogP | 1.04 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|