C9H18N2O3 — CID 142299481
[2-(methylamino)acetyl] (2S,3R)-2-amino-3-methylpentanoate (PubChem CID 142299481) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is [2-(methylamino)acetyl] (2S,3R)-2-amino-3-methylpentanoate.
| Compound Name | [2-(methylamino)acetyl] (2S,3R)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 142299481 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | [2-(methylamino)acetyl] (2S,3R)-2-amino-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)OC(=O)CNC |
| InChI | InChI=1S/C9H18N2O3/c1-4-6(2)8(10)9(13)14-7(12)5-11-3/h6,8,11H,4-5,10H2,1-3H3/t6-,8+/m1/s1 |
| InChIKey | URCCMHCZTSXKIB-SVRRBLITSA-N |
| XLogP | -0.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|